C26H39NO5 — CID 134114611
3-[(2-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-N,N-dimethylpropan-1-amine;(E)-but-2-enedioic acid (PubChem CID 134114611) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is 3-[(2-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-N,N-dimethylpropan-1-amine;(E)-but-2-enedioic acid.
| Compound Name | 3-[(2-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-N,N-dimethylpropan-1-amine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 134114611 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 3-[(2-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-N,N-dimethylpropan-1-amine;(E)-but-2-enedioic acid |
| SMILES | CN(C)CCCOC1(Cc2ccccc2)CC2CCC1(C)C2(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H35NO.C4H4O4/c1-20(2)19-12-13-21(20,3)22(17-19,24-15-9-14-23(4)5)16-18-10-7-6-8-11-18;5-3(6)1-2-4(7)8/h6-8,10-11,19H,9,12-17H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PIFWDVZAALBTPQ-WLHGVMLRSA-N |
| XLogP | 4.49 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|