C22H32O3Si — CID 10547315
[(2S,3R)-3-phenyloxiran-2-yl]-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 10547315) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is [(2S,3R)-3-phenyloxiran-2-yl]-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(2S,3R)-3-phenyloxiran-2-yl]-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 10547315 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [(2S,3R)-3-phenyloxiran-2-yl]-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@](O[Si](C)(C)C)(C(=O)[C@H]1O[C@@H]1c1ccccc1)C2 |
| InChI | InChI=1S/C22H32O3Si/c1-20(2)16-12-13-21(20,3)22(14-16,25-26(4,5)6)19(23)18-17(24-18)15-10-8-7-9-11-15/h7-11,16-18H,12-14H2,1-6H3/t16-,17-,18+,21-,22+/m1/s1 |
| InChIKey | FJYYFXPICLNRAS-CEMPCABHSA-N |
| XLogP | 5.13 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|