C26H32NO4P — CID 11190239
(2R,3S)-3-(dibenzylamino)-1-dimethoxyphosphoryl-4-phenylbutan-2-ol (PubChem CID 11190239) has the molecular formula C26H32NO4P and a molecular weight of 453.52 g/mol. Its IUPAC name is (2R,3S)-3-(dibenzylamino)-1-dimethoxyphosphoryl-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-(dibenzylamino)-1-dimethoxyphosphoryl-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 11190239 |
| Molecular Formula | C26H32NO4P |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (2R,3S)-3-(dibenzylamino)-1-dimethoxyphosphoryl-4-phenylbutan-2-ol |
| SMILES | COP(=O)(C[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)OC |
| InChI | InChI=1S/C26H32NO4P/c1-30-32(29,31-2)21-26(28)25(18-22-12-6-3-7-13-22)27(19-23-14-8-4-9-15-23)20-24-16-10-5-11-17-24/h3-17,25-26,28H,18-21H2,1-2H3/t25-,26-/m0/s1 |
| InChIKey | ZHYCWQYTLXYAIQ-UIOOFZCWSA-N |
| XLogP | 5.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|