C16H28N2 — CID 134822170
1,7,7-trimethyl-N-(2-pyrrolidin-1-ylethyl)bicyclo[2.2.1]heptan-2-imine (PubChem CID 134822170) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1,7,7-trimethyl-N-(2-pyrrolidin-1-ylethyl)bicyclo[2.2.1]heptan-2-imine.
| Compound Name | 1,7,7-trimethyl-N-(2-pyrrolidin-1-ylethyl)bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 134822170 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1,7,7-trimethyl-N-(2-pyrrolidin-1-ylethyl)bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC12CCC(C/C1=N\CCN1CCCC1)C2(C)C |
| InChI | InChI=1S/C16H28N2/c1-15(2)13-6-7-16(15,3)14(12-13)17-8-11-18-9-4-5-10-18/h13H,4-12H2,1-3H3/b17-14+ |
| InChIKey | RDFDLFXKYMPSKE-SAPNQHFASA-N |
| XLogP | 3.37 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|