C25H36N2O — CID 134179893
(3R,5R,8R,9R,10S,13S,14S)-3,13-dimethyl-17-(pyridin-2-ylmethylimino)-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 134179893) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S)-3,13-dimethyl-17-(pyridin-2-ylmethylimino)-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S)-3,13-dimethyl-17-(pyridin-2-ylmethylimino)-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134179893 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S)-3,13-dimethyl-17-(pyridin-2-ylmethylimino)-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@]1(O)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)/C(=N/Cc4ccccn4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H36N2O/c1-24(28)12-10-19-17(15-24)6-7-21-20(19)11-13-25(2)22(21)8-9-23(25)27-16-18-5-3-4-14-26-18/h3-5,14,17,19-22,28H,6-13,15-16H2,1-2H3/b27-23+/t17-,19+,20-,21-,22+,24-,25+/m1/s1 |
| InChIKey | OCRRFSBKWSPBAF-ZDPPQQSDSA-N |
| XLogP | 5.43 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|