C26H36O2P+ — CID 174992208
[(3R,5R,8R,9R,10S,13S,14S)-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-(2-methylphenyl)-oxophosphanium (PubChem CID 174992208) has the molecular formula C26H36O2P+ and a molecular weight of 411.55 g/mol. Its IUPAC name is [(3R,5R,8R,9R,10S,13S,14S)-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-(2-methylphenyl)-oxophosphanium.
| Compound Name | [(3R,5R,8R,9R,10S,13S,14S)-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-(2-methylphenyl)-oxophosphanium |
|---|---|
| PubChem CID | 174992208 |
| Molecular Formula | C26H36O2P+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | [(3R,5R,8R,9R,10S,13S,14S)-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-(2-methylphenyl)-oxophosphanium |
| SMILES | Cc1ccccc1[P+](=O)C1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@](C)(O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H36O2P/c1-17-6-4-5-7-23(17)29(28)24-11-10-22-21-9-8-18-16-25(2,27)14-12-19(18)20(21)13-15-26(22,24)3/h4-7,11,18-22,27H,8-10,12-16H2,1-3H3/q+1/t18-,19+,20-,21-,22+,25-,26+/m1/s1 |
| InChIKey | YCRUFFYAMWEQEK-PHUZURLRSA-N |
| XLogP | 6.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|