C21H34O2 — CID 166042184
(4R,4aS,4bR,6aS,8R,10aS,10bR,12aS)-8-hydroxy-4,8,12a-trimethyl-3,4,4a,4b,5,6,6a,7,9,10,10a,10b,11,12-tetradecahydro-2H-chrysen-1-one (PubChem CID 166042184) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (4R,4aS,4bR,6aS,8R,10aS,10bR,12aS)-8-hydroxy-4,8,12a-trimethyl-3,4,4a,4b,5,6,6a,7,9,10,10a,10b,11,12-tetradecahydro-2H-chrysen-1-one.
| Compound Name | (4R,4aS,4bR,6aS,8R,10aS,10bR,12aS)-8-hydroxy-4,8,12a-trimethyl-3,4,4a,4b,5,6,6a,7,9,10,10a,10b,11,12-tetradecahydro-2H-chrysen-1-one |
|---|---|
| PubChem CID | 166042184 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (4R,4aS,4bR,6aS,8R,10aS,10bR,12aS)-8-hydroxy-4,8,12a-trimethyl-3,4,4a,4b,5,6,6a,7,9,10,10a,10b,11,12-tetradecahydro-2H-chrysen-1-one |
| SMILES | C[C@@H]1CCC(=O)[C@@]2(C)CC[C@H]3[C@@H](CC[C@H]4C[C@](C)(O)CC[C@@H]43)[C@H]12 |
| InChI | InChI=1S/C21H34O2/c1-13-4-7-18(22)21(3)11-9-16-15-8-10-20(2,23)12-14(15)5-6-17(16)19(13)21/h13-17,19,23H,4-12H2,1-3H3/t13-,14+,15+,16-,17-,19+,20-,21-/m1/s1 |
| InChIKey | MIEDZPFLYXQLRR-JKXSLIAXSA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |