C20H32O2 — CID 153418724
(3R,5R,8R,9R,10S,13S,14S,16R)-3-hydroxy-3,13,16-trimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 153418724) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,16R)-3-hydroxy-3,13,16-trimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,16R)-3-hydroxy-3,13,16-trimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 153418724 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,16R)-3-hydroxy-3,13,16-trimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CC[C@@H]4C[C@](C)(O)CC[C@@H]4[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C20H32O2/c1-12-10-17-16-5-4-13-11-19(2,22)8-6-14(13)15(16)7-9-20(17,3)18(12)21/h12-17,22H,4-11H2,1-3H3/t12-,13-,14+,15-,16-,17+,19-,20+/m1/s1 |
| InChIKey | JNVGOZWIUBSXMW-GRFMMZRASA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |