C18H32O — CID 155396202
(2R,4aS,4bR,8S,8aR,10aR)-2,7,7,8-tetramethyl-1,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-ol (PubChem CID 155396202) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (2R,4aS,4bR,8S,8aR,10aR)-2,7,7,8-tetramethyl-1,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-ol.
| Compound Name | (2R,4aS,4bR,8S,8aR,10aR)-2,7,7,8-tetramethyl-1,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 155396202 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (2R,4aS,4bR,8S,8aR,10aR)-2,7,7,8-tetramethyl-1,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-ol |
| SMILES | C[C@H]1[C@@H]2CC[C@@H]3C[C@](C)(O)CC[C@@H]3[C@H]2CCC1(C)C |
| InChI | InChI=1S/C18H32O/c1-12-14-6-5-13-11-18(4,19)10-8-15(13)16(14)7-9-17(12,2)3/h12-16,19H,5-11H2,1-4H3/t12-,13+,14-,15-,16-,18+/m0/s1 |
| InChIKey | BQOMKBSOWRVKFE-SRFBJZQXSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |