C26H44N2O2 — CID 138552626
(3R,5S,8R,9R,10S,13S,14S,17E)-17-[1-hydroxy-2-(4-methylpiperazin-1-yl)ethylidene]-3,13-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 138552626) has the molecular formula C26H44N2O2 and a molecular weight of 416.65 g/mol. Its IUPAC name is (3R,5S,8R,9R,10S,13S,14S,17E)-17-[1-hydroxy-2-(4-methylpiperazin-1-yl)ethylidene]-3,13-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8R,9R,10S,13S,14S,17E)-17-[1-hydroxy-2-(4-methylpiperazin-1-yl)ethylidene]-3,13-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 138552626 |
| Molecular Formula | C26H44N2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | (3R,5S,8R,9R,10S,13S,14S,17E)-17-[1-hydroxy-2-(4-methylpiperazin-1-yl)ethylidene]-3,13-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CN1CCN(C/C(O)=C2/CC[C@H]3[C@@H]4CC[C@H]5C[C@](C)(O)CC[C@@H]5[C@H]4CC[C@]23C)CC1 |
| InChI | InChI=1S/C26H44N2O2/c1-25(30)10-8-19-18(16-25)4-5-21-20(19)9-11-26(2)22(21)6-7-23(26)24(29)17-28-14-12-27(3)13-15-28/h18-22,29-30H,4-17H2,1-3H3/b24-23+/t18-,19-,20+,21+,22-,25+,26-/m0/s1 |
| InChIKey | BGLXKPXNMSMKRZ-XXEOZORTSA-N |
| XLogP | 4.45 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|