C20H23NO2S — CID 8893915
(2S)-1-(1-adamantyl)-2-(1,3-benzoxazol-2-ylsulfanyl)propan-1-one (PubChem CID 8893915) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is (2S)-1-(1-adamantyl)-2-(1,3-benzoxazol-2-ylsulfanyl)propan-1-one.
| Compound Name | (2S)-1-(1-adamantyl)-2-(1,3-benzoxazol-2-ylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 8893915 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S)-1-(1-adamantyl)-2-(1,3-benzoxazol-2-ylsulfanyl)propan-1-one |
| SMILES | C[C@H](Sc1nc2ccccc2o1)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H23NO2S/c1-12(24-19-21-16-4-2-3-5-17(16)23-19)18(22)20-9-13-6-14(10-20)8-15(7-13)11-20/h2-5,12-15H,6-11H2,1H3/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | KNFCANKUBFOIIP-PGBBXINNSA-N |
| XLogP | 5.09 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |