C15H11NO3S — CID 3769169
2-(1,3-benzoxazol-2-ylsulfanyl)-2-phenylacetic acid (PubChem CID 3769169) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-2-phenylacetic acid.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 3769169 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-2-phenylacetic acid |
| SMILES | O=C(O)C(Sc1nc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C15H11NO3S/c17-14(18)13(10-6-2-1-3-7-10)20-15-16-11-8-4-5-9-12(11)19-15/h1-9,13H,(H,17,18) |
| InChIKey | GWEDGROZKOAEGM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |