C12H10FN3O3 — CID 175507495
4-(2-fluoro-3-nitrophenyl)-2,5-dimethylpyridazin-3-one (PubChem CID 175507495) has the molecular formula C12H10FN3O3 and a molecular weight of 263.23 g/mol. Its IUPAC name is 4-(2-fluoro-3-nitrophenyl)-2,5-dimethylpyridazin-3-one.
| Compound Name | 4-(2-fluoro-3-nitrophenyl)-2,5-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 175507495 |
| Molecular Formula | C12H10FN3O3 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-(2-fluoro-3-nitrophenyl)-2,5-dimethylpyridazin-3-one |
| SMILES | Cc1cnn(C)c(=O)c1-c1cccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H10FN3O3/c1-7-6-14-15(2)12(17)10(7)8-4-3-5-9(11(8)13)16(18)19/h3-6H,1-2H3 |
| InChIKey | XNLHIGQKXPCVKQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|