C13H5F4NO3 — CID 102030733
2,3,5,6-tetrafluoro-4-(4-nitrophenyl)benzaldehyde (PubChem CID 102030733) has the molecular formula C13H5F4NO3 and a molecular weight of 299.18 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(4-nitrophenyl)benzaldehyde.
| Compound Name | 2,3,5,6-tetrafluoro-4-(4-nitrophenyl)benzaldehyde |
|---|---|
| PubChem CID | 102030733 |
| Molecular Formula | C13H5F4NO3 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(4-nitrophenyl)benzaldehyde |
| SMILES | O=Cc1c(F)c(F)c(-c2ccc([N+](=O)[O-])cc2)c(F)c1F |
| InChI | InChI=1S/C13H5F4NO3/c14-10-8(5-19)11(15)13(17)9(12(10)16)6-1-3-7(4-2-6)18(20)21/h1-5H |
| InChIKey | PJZWAHFRCTXPHA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|