C14H7F5N2O2 — CID 173249376
4-nitro-N-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]aniline (PubChem CID 173249376) has the molecular formula C14H7F5N2O2 and a molecular weight of 330.21 g/mol. Its IUPAC name is 4-nitro-N-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]aniline.
| Compound Name | 4-nitro-N-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 173249376 |
| Molecular Formula | C14H7F5N2O2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-nitro-N-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(NC=Cc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H7F5N2O2/c15-10-9(11(16)13(18)14(19)12(10)17)5-6-20-7-1-3-8(4-2-7)21(22)23/h1-6,20H |
| InChIKey | PKWDVDXOVSXPEG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|