C18H5BF10N2O4S — CID 122402800
N-bis(2,3,4,5,6-pentafluorophenyl)boranyl-4-nitrobenzenesulfonamide (PubChem CID 122402800) has the molecular formula C18H5BF10N2O4S and a molecular weight of 546.11 g/mol. Its IUPAC name is N-bis(2,3,4,5,6-pentafluorophenyl)boranyl-4-nitrobenzenesulfonamide.
| Compound Name | N-bis(2,3,4,5,6-pentafluorophenyl)boranyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122402800 |
| Molecular Formula | C18H5BF10N2O4S |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.99 |
| IUPAC Name | N-bis(2,3,4,5,6-pentafluorophenyl)boranyl-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NB(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H5BF10N2O4S/c20-9-7(10(21)14(25)17(28)13(9)24)19(8-11(22)15(26)18(29)16(27)12(8)23)30-36(34,35)6-3-1-5(2-4-6)31(32)33/h1-4,30H |
| InChIKey | DCJOSVOENWLIHY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|