About 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide
4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide (PubChem CID 91082928) has the molecular formula C15H14ClN3O9S2
and a molecular weight of 479.88 g/mol. Its IUPAC name is 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide |
| PubChem CID | 91082928 |
| Molecular Formula | C15H14ClN3O9S2 |
| Molecular Weight | 479.88 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide |
| SMILES | CC(=O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C9H10N2O5S.C6H4ClNO4S/c1-7(12)6-10-17(15,16)9-4-2-8(3-5-9)11(13)14;7-13(11,12)6-3-1-5(2-4-6)8(9)10/h2-5,10H,6H2,1H3;1-4H |
| InChIKey | BKAZXGVBRFIWIC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 183.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.88 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide?
The IUPAC name of 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide (CID 91082928) is 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide.
What is the SMILES notation for 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide?
The canonical SMILES for 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide is CC(=O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide?
The InChIKey is BKAZXGVBRFIWIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O5S.C6H4ClNO4S/c1-7(12)6-10-17(15,16)9-4-2-8(3-5-9)11(13)14;7-13(11,12)6-3-1-5(2-4-6)8(9)10/h2-5,10H,6H2,1H3;1-4H.
What are the key properties of 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide?
4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide has a molecular weight of 479.88 g/mol, XLogP of 1.98, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrobenzenesulfonyl chloride;4-nitro-N-(2-oxopropyl)benzenesulfonamide is sourced from PubChem (CID 91082928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).