C15H21N3O7S — CID 155270917
methyl 3-methyl-2-[[2-[(4-nitrophenyl)sulfonylamino]acetyl]amino]pentanoate (PubChem CID 155270917) has the molecular formula C15H21N3O7S and a molecular weight of 387.41 g/mol. Its IUPAC name is methyl 3-methyl-2-[[2-[(4-nitrophenyl)sulfonylamino]acetyl]amino]pentanoate.
| Compound Name | methyl 3-methyl-2-[[2-[(4-nitrophenyl)sulfonylamino]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 155270917 |
| Molecular Formula | C15H21N3O7S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | methyl 3-methyl-2-[[2-[(4-nitrophenyl)sulfonylamino]acetyl]amino]pentanoate |
| SMILES | CCC(C)C(NC(=O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OC |
| InChI | InChI=1S/C15H21N3O7S/c1-4-10(2)14(15(20)25-3)17-13(19)9-16-26(23,24)12-7-5-11(6-8-12)18(21)22/h5-8,10,14,16H,4,9H2,1-3H3,(H,17,19) |
| InChIKey | PXUIMXLZZLAOFH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|