C16H23N3O7S — CID 155717775
methyl (2S,3S)-3-methyl-2-[[(2S)-2-[(4-nitrophenyl)sulfonylamino]propanoyl]amino]pentanoate (PubChem CID 155717775) has the molecular formula C16H23N3O7S and a molecular weight of 401.44 g/mol. Its IUPAC name is methyl (2S,3S)-3-methyl-2-[[(2S)-2-[(4-nitrophenyl)sulfonylamino]propanoyl]amino]pentanoate.
| Compound Name | methyl (2S,3S)-3-methyl-2-[[(2S)-2-[(4-nitrophenyl)sulfonylamino]propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 155717775 |
| Molecular Formula | C16H23N3O7S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | methyl (2S,3S)-3-methyl-2-[[(2S)-2-[(4-nitrophenyl)sulfonylamino]propanoyl]amino]pentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](C)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OC |
| InChI | InChI=1S/C16H23N3O7S/c1-5-10(2)14(16(21)26-4)17-15(20)11(3)18-27(24,25)13-8-6-12(7-9-13)19(22)23/h6-11,14,18H,5H2,1-4H3,(H,17,20)/t10-,11-,14-/m0/s1 |
| InChIKey | FOESZIIUBFFOQX-MJVIPROJSA-N |
| XLogP | 0.97 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|