C17H25N3O6 — CID 67912165
(2S,3S)-2-[[(4S)-4-amino-3-hydroxy-5-(4-nitrophenyl)pentanoyl]amino]-3-methylpentanoic acid (PubChem CID 67912165) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is (2S,3S)-2-[[(4S)-4-amino-3-hydroxy-5-(4-nitrophenyl)pentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(4S)-4-amino-3-hydroxy-5-(4-nitrophenyl)pentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 67912165 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (2S,3S)-2-[[(4S)-4-amino-3-hydroxy-5-(4-nitrophenyl)pentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)CC(O)[C@@H](N)Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C17H25N3O6/c1-3-10(2)16(17(23)24)19-15(22)9-14(21)13(18)8-11-4-6-12(7-5-11)20(25)26/h4-7,10,13-14,16,21H,3,8-9,18H2,1-2H3,(H,19,22)(H,23,24)/t10-,13-,14?,16-/m0/s1 |
| InChIKey | LGHQVLGIQRTEFN-IHWHAYLTSA-N |
| XLogP | 0.83 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|