C27H42N4O8 — CID 11699606
(2S)-2-[[(2S)-2-[[(3S,4S)-3-[(2R,3S)-2-amino-3-methylpentanoyl]oxy-4-methyloctanoyl]amino]-3-(4-nitrophenyl)propanoyl]amino]propanoic acid (PubChem CID 11699606) has the molecular formula C27H42N4O8 and a molecular weight of 550.65 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(3S,4S)-3-[(2R,3S)-2-amino-3-methylpentanoyl]oxy-4-methyloctanoyl]amino]-3-(4-nitrophenyl)propanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(3S,4S)-3-[(2R,3S)-2-amino-3-methylpentanoyl]oxy-4-methyloctanoyl]amino]-3-(4-nitrophenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11699606 |
| Molecular Formula | C27H42N4O8 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(3S,4S)-3-[(2R,3S)-2-amino-3-methylpentanoyl]oxy-4-methyloctanoyl]amino]-3-(4-nitrophenyl)propanoyl]amino]propanoic acid |
| SMILES | CCCC[C@H](C)[C@H](CC(=O)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)N[C@@H](C)C(=O)O)OC(=O)[C@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C27H42N4O8/c1-6-8-9-17(4)22(39-27(36)24(28)16(3)7-2)15-23(32)30-21(25(33)29-18(5)26(34)35)14-19-10-12-20(13-11-19)31(37)38/h10-13,16-18,21-22,24H,6-9,14-15,28H2,1-5H3,(H,29,33)(H,30,32)(H,34,35)/t16-,17-,18-,21-,22-,24+/m0/s1 |
| InChIKey | KCFSJWMTPDXACO-FRBKHAKBSA-N |
| XLogP | 2.71 |
| TPSA | 190.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|