C33H45N3O7 — CID 11664347
(2S)-2-[[(2S)-2-[[(3R)-3-[(2R,3S)-2-amino-3-methylpentanoyl]oxyoctanoyl]amino]-3-(4-benzoylphenyl)propanoyl]amino]propanoic acid (PubChem CID 11664347) has the molecular formula C33H45N3O7 and a molecular weight of 595.74 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(3R)-3-[(2R,3S)-2-amino-3-methylpentanoyl]oxyoctanoyl]amino]-3-(4-benzoylphenyl)propanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(3R)-3-[(2R,3S)-2-amino-3-methylpentanoyl]oxyoctanoyl]amino]-3-(4-benzoylphenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11664347 |
| Molecular Formula | C33H45N3O7 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(3R)-3-[(2R,3S)-2-amino-3-methylpentanoyl]oxyoctanoyl]amino]-3-(4-benzoylphenyl)propanoyl]amino]propanoic acid |
| SMILES | CCCCC[C@H](CC(=O)N[C@@H](Cc1ccc(C(=O)c2ccccc2)cc1)C(=O)N[C@@H](C)C(=O)O)OC(=O)[C@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C33H45N3O7/c1-5-7-9-14-26(43-33(42)29(34)21(3)6-2)20-28(37)36-27(31(39)35-22(4)32(40)41)19-23-15-17-25(18-16-23)30(38)24-12-10-8-11-13-24/h8,10-13,15-18,21-22,26-27,29H,5-7,9,14,19-20,34H2,1-4H3,(H,35,39)(H,36,37)(H,40,41)/t21-,22-,26+,27-,29+/m0/s1 |
| InChIKey | UMXOPMDJLQYIDJ-QQSAWJEBSA-N |
| XLogP | 3.79 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|