C20H21N3O5S — CID 169259836
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-[(4-nitrophenyl)sulfonylamino]acetamide (PubChem CID 169259836) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-[(4-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-[(4-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 169259836 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-[(4-nitrophenyl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C20H21N3O5S/c24-19(12-21-29(27,28)16-9-7-15(8-10-16)23(25)26)22-20-17-5-1-3-13(17)11-14-4-2-6-18(14)20/h7-11,21H,1-6,12H2,(H,22,24) |
| InChIKey | CNIKIALYVJQHPI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|