C31H35N3O6S — CID 169259908
(2S)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 169259908) has the molecular formula C31H35N3O6S and a molecular weight of 577.70 g/mol. Its IUPAC name is (2S)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 169259908 |
| Molecular Formula | C31H35N3O6S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | (2S)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | CC(C)(C)Oc1ccc(C[C@H](NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)C(=O)Nc2c3c(cc4c2CCC4)CCC3)cc1 |
| InChI | InChI=1S/C31H35N3O6S/c1-31(2,3)40-24-14-10-20(11-15-24)18-28(33-41(38,39)25-16-12-23(13-17-25)34(36)37)30(35)32-29-26-8-4-6-21(26)19-22-7-5-9-27(22)29/h10-17,19,28,33H,4-9,18H2,1-3H3,(H,32,35)/t28-/m0/s1 |
| InChIKey | PMXZKEIMCOWHRM-NDEPHWFRSA-N |
| XLogP | 5.28 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|