C12H6F5N3O2 — CID 133086486
4-methyl-3-nitro-5-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine (PubChem CID 133086486) has the molecular formula C12H6F5N3O2 and a molecular weight of 319.19 g/mol. Its IUPAC name is 4-methyl-3-nitro-5-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine.
| Compound Name | 4-methyl-3-nitro-5-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133086486 |
| Molecular Formula | C12H6F5N3O2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-methyl-3-nitro-5-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine |
| SMILES | Cc1c(-c2c(F)c(F)c(F)c(F)c2F)cnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H6F5N3O2/c1-3-4(2-19-12(18)11(3)20(21)22)5-6(13)8(15)10(17)9(16)7(5)14/h2H,1H3,(H2,18,19) |
| InChIKey | JEWYQECJAWXFFL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|