C12H13BrN6O4 — CID 161111660
5-bromo-4-methyl-3-nitropyridin-2-amine;4-methyl-3-nitropyridin-2-amine (PubChem CID 161111660) has the molecular formula C12H13BrN6O4 and a molecular weight of 385.18 g/mol. Its IUPAC name is 5-bromo-4-methyl-3-nitropyridin-2-amine;4-methyl-3-nitropyridin-2-amine.
| Compound Name | 5-bromo-4-methyl-3-nitropyridin-2-amine;4-methyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 161111660 |
| Molecular Formula | C12H13BrN6O4 |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 5-bromo-4-methyl-3-nitropyridin-2-amine;4-methyl-3-nitropyridin-2-amine |
| SMILES | Cc1c(Br)cnc(N)c1[N+](=O)[O-].Cc1ccnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6BrN3O2.C6H7N3O2/c1-3-4(7)2-9-6(8)5(3)10(11)12;1-4-2-3-8-6(7)5(4)9(10)11/h2H,1H3,(H2,8,9);2-3H,1H3,(H2,7,8) |
| InChIKey | UJTQGXPBZVESQR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 164.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|