C9H15BrN2 — CID 145431930
5-bromo-3,4-dimethylpyridin-2-amine;ethane (PubChem CID 145431930) has the molecular formula C9H15BrN2 and a molecular weight of 231.14 g/mol. Its IUPAC name is 5-bromo-3,4-dimethylpyridin-2-amine;ethane.
| Compound Name | 5-bromo-3,4-dimethylpyridin-2-amine;ethane |
|---|---|
| PubChem CID | 145431930 |
| Molecular Formula | C9H15BrN2 |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 5-bromo-3,4-dimethylpyridin-2-amine;ethane |
| SMILES | CC.Cc1c(Br)cnc(N)c1C |
| InChI | InChI=1S/C7H9BrN2.C2H6/c1-4-5(2)7(9)10-3-6(4)8;1-2/h3H,1-2H3,(H2,9,10);1-2H3 |
| InChIKey | FUXKYGGJXIIHFQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |