C10H13BrN2S — CID 142968737
3-bromo-7-methylthieno[3,2-c]pyridin-4-amine;ethane (PubChem CID 142968737) has the molecular formula C10H13BrN2S and a molecular weight of 273.20 g/mol. Its IUPAC name is 3-bromo-7-methylthieno[3,2-c]pyridin-4-amine;ethane.
| Compound Name | 3-bromo-7-methylthieno[3,2-c]pyridin-4-amine;ethane |
|---|---|
| PubChem CID | 142968737 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 3-bromo-7-methylthieno[3,2-c]pyridin-4-amine;ethane |
| SMILES | CC.Cc1cnc(N)c2c(Br)csc12 |
| InChI | InChI=1S/C8H7BrN2S.C2H6/c1-4-2-11-8(10)6-5(9)3-12-7(4)6;1-2/h2-3H,1H3,(H2,10,11);1-2H3 |
| InChIKey | SADSRQPGGIUEHK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |