C6H9Br2N3 — CID 143486522
3,5-dibromopyrazin-2-amine;ethane (PubChem CID 143486522) has the molecular formula C6H9Br2N3 and a molecular weight of 282.97 g/mol. Its IUPAC name is 3,5-dibromopyrazin-2-amine;ethane.
| Compound Name | 3,5-dibromopyrazin-2-amine;ethane |
|---|---|
| PubChem CID | 143486522 |
| Molecular Formula | C6H9Br2N3 |
| Molecular Weight | 282.97 g/mol |
| Exact Mass | 280.92 |
| IUPAC Name | 3,5-dibromopyrazin-2-amine;ethane |
| SMILES | CC.Nc1ncc(Br)nc1Br |
| InChI | InChI=1S/C4H3Br2N3.C2H6/c5-2-1-8-4(7)3(6)9-2;1-2/h1H,(H2,7,8);1-2H3 |
| InChIKey | OLGYDLXTIZBTEP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.97 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |