C7H3F3N2O4 — CID 53429897
1,3,5-trifluoro-2-methyl-4,6-dinitrobenzene (PubChem CID 53429897) has the molecular formula C7H3F3N2O4 and a molecular weight of 236.10 g/mol. Its IUPAC name is 1,3,5-trifluoro-2-methyl-4,6-dinitrobenzene.
| Compound Name | 1,3,5-trifluoro-2-methyl-4,6-dinitrobenzene |
|---|---|
| PubChem CID | 53429897 |
| Molecular Formula | C7H3F3N2O4 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 1,3,5-trifluoro-2-methyl-4,6-dinitrobenzene |
| SMILES | Cc1c(F)c([N+](=O)[O-])c(F)c([N+](=O)[O-])c1F |
| InChI | InChI=1S/C7H3F3N2O4/c1-2-3(8)6(11(13)14)5(10)7(4(2)9)12(15)16/h1H3 |
| InChIKey | RDFGFZDVSHNRMV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|