C11H12F3NO2 — CID 167696751
1-tert-butyl-2,3,5-trifluoro-6-methyl-4-nitrobenzene (PubChem CID 167696751) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 1-tert-butyl-2,3,5-trifluoro-6-methyl-4-nitrobenzene.
| Compound Name | 1-tert-butyl-2,3,5-trifluoro-6-methyl-4-nitrobenzene |
|---|---|
| PubChem CID | 167696751 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-tert-butyl-2,3,5-trifluoro-6-methyl-4-nitrobenzene |
| SMILES | Cc1c(F)c([N+](=O)[O-])c(F)c(F)c1C(C)(C)C |
| InChI | InChI=1S/C11H12F3NO2/c1-5-6(11(2,3)4)8(13)9(14)10(7(5)12)15(16)17/h1-4H3 |
| InChIKey | CFAGYTXZIZWDAS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|