C12H15ClN2O4 — CID 20557073
1-tert-butyl-4-chloro-3,5-dimethyl-2,6-dinitrobenzene (PubChem CID 20557073) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.72 g/mol. Its IUPAC name is 1-tert-butyl-4-chloro-3,5-dimethyl-2,6-dinitrobenzene.
| Compound Name | 1-tert-butyl-4-chloro-3,5-dimethyl-2,6-dinitrobenzene |
|---|---|
| PubChem CID | 20557073 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-tert-butyl-4-chloro-3,5-dimethyl-2,6-dinitrobenzene |
| SMILES | Cc1c(Cl)c(C)c([N+](=O)[O-])c(C(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15ClN2O4/c1-6-9(13)7(2)11(15(18)19)8(12(3,4)5)10(6)14(16)17/h1-5H3 |
| InChIKey | FLGCGCPELSLNRW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|