C14H20FN5O6 — CID 15142099
1-N,3-N-ditert-butyl-5-fluoro-2,4,6-trinitrobenzene-1,3-diamine (PubChem CID 15142099) has the molecular formula C14H20FN5O6 and a molecular weight of 373.34 g/mol. Its IUPAC name is 1-N,3-N-ditert-butyl-5-fluoro-2,4,6-trinitrobenzene-1,3-diamine.
| Compound Name | 1-N,3-N-ditert-butyl-5-fluoro-2,4,6-trinitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 15142099 |
| Molecular Formula | C14H20FN5O6 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-N,3-N-ditert-butyl-5-fluoro-2,4,6-trinitrobenzene-1,3-diamine |
| SMILES | CC(C)(C)Nc1c([N+](=O)[O-])c(F)c([N+](=O)[O-])c(NC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20FN5O6/c1-13(2,3)16-8-10(18(21)22)7(15)11(19(23)24)9(12(8)20(25)26)17-14(4,5)6/h16-17H,1-6H3 |
| InChIKey | JTPWIZOSMQWAFA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|