N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride

C7HClF4N2O3 — CID 135378900

IUPACN-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride
SMILESO=C(Cl)Nc1c(F)c(F)c(F)c(F)c1[N+](=O)[O-]
InChIInChI=1S/C7HClF4N2O3/c8-7(15)13-5-3(11)1(9)2(10)4(12)6(5)14(16)17/h(H,13,15)
InChIKeyUMSAXNMCAYKEAQ-UHFFFAOYSA-N
MW272.54 g/mol
LogP2.92
Rot. Bonds2

About N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride

N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride (PubChem CID 135378900) has the molecular formula C7HClF4N2O3 and a molecular weight of 272.54 g/mol. Its IUPAC name is N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride.

Molecular Properties

Compound NameN-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride
PubChem CID135378900
Molecular FormulaC7HClF4N2O3
Molecular Weight272.54 g/mol
Exact Mass271.96
IUPAC NameN-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride
SMILESO=C(Cl)Nc1c(F)c(F)c(F)c(F)c1[N+](=O)[O-]
InChIInChI=1S/C7HClF4N2O3/c8-7(15)13-5-3(11)1(9)2(10)4(12)6(5)14(16)17/h(H,13,15)
InChIKeyUMSAXNMCAYKEAQ-UHFFFAOYSA-N
XLogP2.92
TPSA72.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.54
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}

Analyze N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride?
The IUPAC name of N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride (CID 135378900) is N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride.
What is the SMILES notation for N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride?
The canonical SMILES for N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride is O=C(Cl)Nc1c(F)c(F)c(F)c(F)c1[N+](=O)[O-].
What is the InChIKey of N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride?
The InChIKey is UMSAXNMCAYKEAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7HClF4N2O3/c8-7(15)13-5-3(11)1(9)2(10)4(12)6(5)14(16)17/h(H,13,15).
What are the key properties of N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride?
N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride has a molecular weight of 272.54 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride is sourced from PubChem (CID 135378900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).