C7HClF4N2O3 — CID 135378900
N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride (PubChem CID 135378900) has the molecular formula C7HClF4N2O3 and a molecular weight of 272.54 g/mol. Its IUPAC name is N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride.
| Compound Name | N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride |
|---|---|
| PubChem CID | 135378900 |
| Molecular Formula | C7HClF4N2O3 |
| Molecular Weight | 272.54 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | N-(2,3,4,5-tetrafluoro-6-nitrophenyl)carbamoyl chloride |
| SMILES | O=C(Cl)Nc1c(F)c(F)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7HClF4N2O3/c8-7(15)13-5-3(11)1(9)2(10)4(12)6(5)14(16)17/h(H,13,15) |
| InChIKey | UMSAXNMCAYKEAQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|