C8H5F4NO3 — CID 91872104
1-ethoxy-2,3,4,5-tetrafluoro-6-nitrobenzene (PubChem CID 91872104) has the molecular formula C8H5F4NO3 and a molecular weight of 239.12 g/mol. Its IUPAC name is 1-ethoxy-2,3,4,5-tetrafluoro-6-nitrobenzene.
| Compound Name | 1-ethoxy-2,3,4,5-tetrafluoro-6-nitrobenzene |
|---|---|
| PubChem CID | 91872104 |
| Molecular Formula | C8H5F4NO3 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 1-ethoxy-2,3,4,5-tetrafluoro-6-nitrobenzene |
| SMILES | CCOc1c(F)c(F)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5F4NO3/c1-2-16-8-6(12)4(10)3(9)5(11)7(8)13(14)15/h2H2,1H3 |
| InChIKey | FWSLVBOUDBPUNJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|