C7H3F4NO3 — CID 4261372
1,2,4,5-tetrafluoro-3-methoxy-6-nitrobenzene (PubChem CID 4261372) has the molecular formula C7H3F4NO3 and a molecular weight of 225.10 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methoxy-6-nitrobenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methoxy-6-nitrobenzene |
|---|---|
| PubChem CID | 4261372 |
| Molecular Formula | C7H3F4NO3 |
| Molecular Weight | 225.10 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methoxy-6-nitrobenzene |
| SMILES | COc1c(F)c(F)c([N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C7H3F4NO3/c1-15-7-4(10)2(8)6(12(13)14)3(9)5(7)11/h1H3 |
| InChIKey | HIOCAQUUJNGLPF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.10 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|