C10H12FNO7S — CID 174648504
(4-fluoro-2,5-dimethoxy-6-methyl-3-nitrophenyl) methanesulfonate (PubChem CID 174648504) has the molecular formula C10H12FNO7S and a molecular weight of 309.27 g/mol. Its IUPAC name is (4-fluoro-2,5-dimethoxy-6-methyl-3-nitrophenyl) methanesulfonate.
| Compound Name | (4-fluoro-2,5-dimethoxy-6-methyl-3-nitrophenyl) methanesulfonate |
|---|---|
| PubChem CID | 174648504 |
| Molecular Formula | C10H12FNO7S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | (4-fluoro-2,5-dimethoxy-6-methyl-3-nitrophenyl) methanesulfonate |
| SMILES | COc1c(C)c(OS(C)(=O)=O)c(OC)c([N+](=O)[O-])c1F |
| InChI | InChI=1S/C10H12FNO7S/c1-5-8(17-2)6(11)7(12(13)14)10(18-3)9(5)19-20(4,15)16/h1-4H3 |
| InChIKey | VVMMGZHIWPSDNH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|