C9H9N3O9 — CID 15386969
1,2,3-trimethoxy-4,5,6-trinitrobenzene (PubChem CID 15386969) has the molecular formula C9H9N3O9 and a molecular weight of 303.18 g/mol. Its IUPAC name is 1,2,3-trimethoxy-4,5,6-trinitrobenzene.
| Compound Name | 1,2,3-trimethoxy-4,5,6-trinitrobenzene |
|---|---|
| PubChem CID | 15386969 |
| Molecular Formula | C9H9N3O9 |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1,2,3-trimethoxy-4,5,6-trinitrobenzene |
| SMILES | COc1c(OC)c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C9H9N3O9/c1-19-7-5(11(15)16)4(10(13)14)6(12(17)18)8(20-2)9(7)21-3/h1-3H3 |
| InChIKey | VDOVEJGIPAXZHE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 157.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|