C7H4Cl2N2O5 — CID 154201735
1,5-dichloro-2-methoxy-3,4-dinitrobenzene (PubChem CID 154201735) has the molecular formula C7H4Cl2N2O5 and a molecular weight of 267.02 g/mol. Its IUPAC name is 1,5-dichloro-2-methoxy-3,4-dinitrobenzene.
| Compound Name | 1,5-dichloro-2-methoxy-3,4-dinitrobenzene |
|---|---|
| PubChem CID | 154201735 |
| Molecular Formula | C7H4Cl2N2O5 |
| Molecular Weight | 267.02 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | 1,5-dichloro-2-methoxy-3,4-dinitrobenzene |
| SMILES | COc1c(Cl)cc(Cl)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4Cl2N2O5/c1-16-7-4(9)2-3(8)5(10(12)13)6(7)11(14)15/h2H,1H3 |
| InChIKey | XPQBSTSIBYXRFK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.02 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|