C14H8N6O14 — CID 14927168
2-methoxy-4-(3-methoxy-2,4,6-trinitrophenyl)-1,3,5-trinitrobenzene (PubChem CID 14927168) has the molecular formula C14H8N6O14 and a molecular weight of 484.25 g/mol. Its IUPAC name is 2-methoxy-4-(3-methoxy-2,4,6-trinitrophenyl)-1,3,5-trinitrobenzene.
| Compound Name | 2-methoxy-4-(3-methoxy-2,4,6-trinitrophenyl)-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 14927168 |
| Molecular Formula | C14H8N6O14 |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 2-methoxy-4-(3-methoxy-2,4,6-trinitrophenyl)-1,3,5-trinitrobenzene |
| SMILES | COc1c([N+](=O)[O-])cc([N+](=O)[O-])c(-c2c([N+](=O)[O-])cc([N+](=O)[O-])c(OC)c2[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8N6O14/c1-33-13-7(17(25)26)3-5(15(21)22)9(11(13)19(29)30)10-6(16(23)24)4-8(18(27)28)14(34-2)12(10)20(31)32/h3-4H,1-2H3 |
| InChIKey | QMSQXUAZXSTGKO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 277.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|