C15H8N2O7 — CID 71720652
2-methoxy-1,3-dinitroanthracene-9,10-dione (PubChem CID 71720652) has the molecular formula C15H8N2O7 and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-methoxy-1,3-dinitroanthracene-9,10-dione.
| Compound Name | 2-methoxy-1,3-dinitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 71720652 |
| Molecular Formula | C15H8N2O7 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-methoxy-1,3-dinitroanthracene-9,10-dione |
| SMILES | COc1c([N+](=O)[O-])cc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H8N2O7/c1-24-15-10(16(20)21)6-9-11(12(15)17(22)23)14(19)8-5-3-2-4-7(8)13(9)18/h2-6H,1H3 |
| InChIKey | WNJOXEVUSWPWTO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|