About sodium;1-nitroanthracene-9,10-dione;sulfanide
sodium;1-nitroanthracene-9,10-dione;sulfanide (PubChem CID 174790562) has the molecular formula C14H8NNaO4S
and a molecular weight of 309.28 g/mol. Its IUPAC name is sodium;1-nitroanthracene-9,10-dione;sulfanide.
Molecular Properties
| Compound Name | sodium;1-nitroanthracene-9,10-dione;sulfanide |
| PubChem CID | 174790562 |
| Molecular Formula | C14H8NNaO4S |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | sodium;1-nitroanthracene-9,10-dione;sulfanide |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2[N+](=O)[O-].[Na+].[SH-] |
| InChI | InChI=1S/C14H7NO4.Na.H2S/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18)19;;/h1-7H;;1H2/q;+1;/p-1 |
| InChIKey | MZKAGQPTFCCFLU-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-nitroanthracene-9,10-dione;sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-nitroanthracene-9,10-dione;sulfanide?
The IUPAC name of sodium;1-nitroanthracene-9,10-dione;sulfanide (CID 174790562) is sodium;1-nitroanthracene-9,10-dione;sulfanide.
What is the SMILES notation for sodium;1-nitroanthracene-9,10-dione;sulfanide?
The canonical SMILES for sodium;1-nitroanthracene-9,10-dione;sulfanide is O=C1c2ccccc2C(=O)c2c1cccc2[N+](=O)[O-].[Na+].[SH-].
What is the InChIKey of sodium;1-nitroanthracene-9,10-dione;sulfanide?
The InChIKey is MZKAGQPTFCCFLU-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H7NO4.Na.H2S/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18)19;;/h1-7H;;1H2/q;+1;/p-1.
What are the key properties of sodium;1-nitroanthracene-9,10-dione;sulfanide?
sodium;1-nitroanthracene-9,10-dione;sulfanide has a molecular weight of 309.28 g/mol, XLogP of -0.90, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-nitroanthracene-9,10-dione;sulfanide is sourced from PubChem (CID 174790562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).