C8H3NO5 — CID 21631
4-nitro-2-benzofuran-1,3-dione (PubChem CID 21631) has the molecular formula C8H3NO5 and a molecular weight of 193.11 g/mol. Its IUPAC name is 4-nitro-2-benzofuran-1,3-dione.
| Compound Name | 4-nitro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 21631 |
| Molecular Formula | C8H3NO5 |
| Molecular Weight | 193.11 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | 4-nitro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C8H3NO5/c10-7-4-2-1-3-5(9(12)13)6(4)8(11)14-7/h1-3H |
| InChIKey | ROFZMKDROVBLNY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.11 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|