C12H5NO6 — CID 14746005
8-hydroxy-7-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (PubChem CID 14746005) has the molecular formula C12H5NO6 and a molecular weight of 259.17 g/mol. Its IUPAC name is 8-hydroxy-7-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione.
| Compound Name | 8-hydroxy-7-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 14746005 |
| Molecular Formula | C12H5NO6 |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 8-hydroxy-7-nitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2cc([N+](=O)[O-])c(O)c3cccc1c23 |
| InChI | InChI=1S/C12H5NO6/c14-10-5-2-1-3-6-9(5)7(4-8(10)13(17)18)12(16)19-11(6)15/h1-4,14H |
| InChIKey | CFIBSUGMQQSVHS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|