C18H8BrNO6 — CID 164906713
8-(4-bromo-2-nitrophenoxy)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 164906713) has the molecular formula C18H8BrNO6 and a molecular weight of 414.17 g/mol. Its IUPAC name is 8-(4-bromo-2-nitrophenoxy)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-(4-bromo-2-nitrophenoxy)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 164906713 |
| Molecular Formula | C18H8BrNO6 |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 412.95 |
| IUPAC Name | 8-(4-bromo-2-nitrophenoxy)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2ccc(Oc3ccc(Br)cc3[N+](=O)[O-])c3cccc1c23 |
| InChI | InChI=1S/C18H8BrNO6/c19-9-4-6-15(13(8-9)20(23)24)25-14-7-5-12-16-10(14)2-1-3-11(16)17(21)26-18(12)22/h1-8H |
| InChIKey | GFKFGQAORRHNED-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|