C30H26N2O6 — CID 118670345
2-[2,6-di(propan-2-yl)phenyl]-6-(4-hydroxy-2-nitrophenoxy)benzo[de]isoquinoline-1,3-dione (PubChem CID 118670345) has the molecular formula C30H26N2O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-6-(4-hydroxy-2-nitrophenoxy)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-6-(4-hydroxy-2-nitrophenoxy)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 118670345 |
| Molecular Formula | C30H26N2O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-6-(4-hydroxy-2-nitrophenoxy)benzo[de]isoquinoline-1,3-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cccc3c(Oc4ccc(O)cc4[N+](=O)[O-])ccc(c23)C1=O |
| InChI | InChI=1S/C30H26N2O6/c1-16(2)19-7-5-8-20(17(3)4)28(19)31-29(34)22-10-6-9-21-25(14-12-23(27(21)22)30(31)35)38-26-13-11-18(33)15-24(26)32(36)37/h5-17,33H,1-4H3 |
| InChIKey | QYJILARIZHSSOX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|