C20H14N2O6 — CID 19577362
2-(2-hydroxyethyl)-6-(2-nitrophenoxy)benzo[de]isoquinoline-1,3-dione (PubChem CID 19577362) has the molecular formula C20H14N2O6 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-6-(2-nitrophenoxy)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-hydroxyethyl)-6-(2-nitrophenoxy)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 19577362 |
| Molecular Formula | C20H14N2O6 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-(2-hydroxyethyl)-6-(2-nitrophenoxy)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(Oc4ccccc4[N+](=O)[O-])ccc(c23)C(=O)N1CCO |
| InChI | InChI=1S/C20H14N2O6/c23-11-10-21-19(24)13-5-3-4-12-16(9-8-14(18(12)13)20(21)25)28-17-7-2-1-6-15(17)22(26)27/h1-9,23H,10-11H2 |
| InChIKey | PIRYEQCEEVELME-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|