C26H15Cl2NO6 — CID 163733267
6-chloro-2-(2-hydroxyethyl)benzo[de]isoquinoline-1,3-dione;8-chloro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 163733267) has the molecular formula C26H15Cl2NO6 and a molecular weight of 508.31 g/mol. Its IUPAC name is 6-chloro-2-(2-hydroxyethyl)benzo[de]isoquinoline-1,3-dione;8-chloro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 6-chloro-2-(2-hydroxyethyl)benzo[de]isoquinoline-1,3-dione;8-chloro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 163733267 |
| Molecular Formula | C26H15Cl2NO6 |
| Molecular Weight | 508.31 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 6-chloro-2-(2-hydroxyethyl)benzo[de]isoquinoline-1,3-dione;8-chloro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2ccc(Cl)c3cccc1c23.O=C1c2cccc3c(Cl)ccc(c23)C(=O)N1CCO |
| InChI | InChI=1S/C14H10ClNO3.C12H5ClO3/c15-11-5-4-10-12-8(11)2-1-3-9(12)13(18)16(6-7-17)14(10)19;13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15/h1-5,17H,6-7H2;1-5H |
| InChIKey | LBLGSNVMXZQYFL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|