C31H28Cl2N4O4 — CID 146995038
6-chloro-2-[2-[3-[2-(6-chloro-1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 146995038) has the molecular formula C31H28Cl2N4O4 and a molecular weight of 591.50 g/mol. Its IUPAC name is 6-chloro-2-[2-[3-[2-(6-chloro-1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-chloro-2-[2-[3-[2-(6-chloro-1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 146995038 |
| Molecular Formula | C31H28Cl2N4O4 |
| Molecular Weight | 591.50 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 6-chloro-2-[2-[3-[2-(6-chloro-1-hydroxy-3-oxo-1H-benzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(Cl)ccc(c23)C(=O)N1CCNCCCNCCN1C(=O)c2ccc(Cl)c3cccc(c23)C1O |
| InChI | InChI=1S/C31H28Cl2N4O4/c32-24-10-8-22-26-18(24)4-1-6-20(26)28(38)36(30(22)40)16-14-34-12-3-13-35-15-17-37-29(39)21-7-2-5-19-25(33)11-9-23(27(19)21)31(37)41/h1-2,4-11,28,34-35,38H,3,12-17H2 |
| InChIKey | AQXSMQGNBPFPPB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|