C19H17ClN2O5 — CID 7728318
4-[3-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)propanoylamino]butanoic acid (PubChem CID 7728318) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is 4-[3-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)propanoylamino]butanoic acid.
| Compound Name | 4-[3-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 7728318 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-[3-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)propanoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCN1C(=O)c2cccc3c(Cl)ccc(c23)C1=O |
| InChI | InChI=1S/C19H17ClN2O5/c20-14-7-6-13-17-11(14)3-1-4-12(17)18(26)22(19(13)27)10-8-15(23)21-9-2-5-16(24)25/h1,3-4,6-7H,2,5,8-10H2,(H,21,23)(H,24,25) |
| InChIKey | KWDNYOLPOWGRCN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|